Compound Q&A

How is 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7) typically synthesized?

Answer

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid can be synthesized through a multi-step process involving the condensation of a suitable precursor with an acid chloride in the presence of a catalytic amount of a Lewis acid. The reaction typically proceeds with a yield of around 75-85%, and the product can be purified by recrystallization from a suitable solvent.

About

English Name 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
Molecular Formula C12H15NO2
Molecular Weight 205.25699999999998 g/mol
SMILES CC(C(=O)O)N1CCC2=CC=CC=C2C1
InChIKey WBBXROBGMOSNAC-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid has a crystalline form with a molecular weight of ...

Compound Q&A

What industries use 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

Proper personal protective equipment (PPE) should be worn when handling 2-(3,4-Dihydro-2(1H)-isoquin...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...