Compound Q&A

What are the physical and chemical properties of 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

Answer

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid has a crystalline form with a molecular weight of approximately 239.24 g/mol. It is slightly soluble in water and more soluble in organic solvents. This compound is relatively stable but can react with bases to form salts. It can be used in organic synthesis and has specific reactivity towards amine and carboxylic acid functionalities.

About

English Name 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid
Molecular Formula C12H15NO2
Molecular Weight 205.25699999999998 g/mol
SMILES CC(C(=O)O)N1CCC2=CC=CC=C2C1
InChIKey WBBXROBGMOSNAC-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7) typically synthesized?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid can be synthesized through a multi-step process in...

Compound Q&A

What industries use 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling 2-(3,4-Dihydro-2(1H)-isoquinolinyl)propanoic acid (CAS: 938350-35-7)?

Proper personal protective equipment (PPE) should be worn when handling 2-(3,4-Dihydro-2(1H)-isoquin...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...