Compound Q&A

What are the physical and chemical properties of 2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5)?

Answer

2-(3,3,3-Trifluoropropyl)benzenesulfonamide
2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5) is a white crystalline solid with a molecular weight of approximately 322.17 g/mol. It is practically insoluble in water but soluble in organic solvents like methanol and acetone. Chemically, it is less reactive than its unsulfonated analog due to the electron-withdrawing nature of the trifluoromethyl group, enhancing its stability and reactivity in certain organic reactions. It also shows moderate lipophilicity, which aids in its distribution in biological systems.

About

CAS No 94125-42-5
English Name 2-(3,3,3-Trifluoropropyl)benzenesulfonamide
Molecular Formula C9H10F3NO2S
Molecular Weight 253.24 g/mol
SMILES C1=CC=C(C(=C1)CCC(F)(F)F)S(=O)(=O)N
InChIKey PIJUMEVHGDAQBH-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5) typically synthesized?

2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5) is typically synthesized through a two...

Compound Q&A

What industries use 2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5)?

2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5) finds applications in various industri...

Compound Q&A

What precautions should be taken when handling 2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5)?

When handling 2-(3,3,3-Trifluoropropyl)benzenesulfonamide (CAS: 94125-42-5), it is crucial to use pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...