Compound Q&A

What industries use Hydrocortisone 11,21-Diacetate (CAS: 81968-66-3)?

Answer

Hydrocortisone 11,21-Diacetate
Hydrocortisone 11,21-Diacetate is primarily used in the pharmaceutical industry for the production of topical corticosteroid preparations. It is also utilized in the research and development of new steroid-based drugs. This compound is less commonly used in other industries such as polymers, sensors, and semiconductors due to its specific biological activity.

About

CAS No 81968-66-3
English Name Hydrocortisone 11,21-Diacetate
Molecular Formula C25H34O7
Molecular Weight 446.533 g/mol
SMILES CC(=O)OCC(=O)[C@]1(CCC2C3CCC4=CC(=O)CC[C@]4(C)C3[C@H](C[C@@]21C)OC(=O)C)O
InChIKey IZCYHZAQYDURFA-AHLMTOPJSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydrocortisone 11,21-Diacetate (CAS: 81968-66-3)?

Hydrocortisone 11,21-Diacetate is a white or off-white crystalline powder with a molecular weight of...

Compound Q&A

How is Hydrocortisone 11,21-Diacetate (CAS: 81968-66-3) typically synthesized?

Hydrocortisone 11,21-Diacetate is typically synthesized by acetylation of hydrocortisone. The reacti...

Compound Q&A

What precautions should be taken when handling Hydrocortisone 11,21-Diacetate (CAS: 81968-66-3)?

When handling Hydrocortisone 11,21-Diacetate, it is essential to wear appropriate personal protectiv...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...