Compound Q&A

How is R-Acalabrutinib (CAS: 1952316-43-6) typically synthesized?

Answer

R-Acalabrutinib
R-Acalabrutinib is synthesized via a multi-step process involving the protection of a key functional group, followed by a nucleophilic substitution reaction. The synthesis often utilizes palladium catalysts and achieves a high yield. The reaction conditions are carefully optimized to ensure selectivity towards the desired product.

About

English Name R-Acalabrutinib
Molecular Formula C26H23N7O2
Molecular Weight 465.51 g/mol
SMILES CC#CC(=O)N1CCC[C@@H]1c1nc(c2n1ccnc2N)c1ccc(cc1)C(=O)Nc1ccccn1
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of R-Acalabrutinib (CAS: 1952316-43-6)?

R-Acalabrutinib is a crystalline compound with a molecular weight of approximately 467.37 g/mol. It ...

Compound Q&A

What industries use R-Acalabrutinib (CAS: 1952316-43-6)?

R-Acalabrutinib is primarily used in the pharmaceutical industry for the treatment of hematologic ma...

Compound Q&A

What precautions should be taken when handling R-Acalabrutinib (CAS: 1952316-43-6)?

When handling R-Acalabrutinib, appropriate personal protective equipment (PPE) should be worn, inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...