Compound Q&A

What are the physical and chemical properties of R-Acalabrutinib (CAS: 1952316-43-6)?

Answer

R-Acalabrutinib
R-Acalabrutinib is a crystalline compound with a molecular weight of approximately 467.37 g/mol. It has a low solubility in water but good solubility in organic solvents like DMSO. Chemically, it is highly reactive towards nucleophilic substitution reactions. It is typically used in pharmaceutical applications where its properties are advantageous.

About

English Name R-Acalabrutinib
Molecular Formula C26H23N7O2
Molecular Weight 465.51 g/mol
SMILES CC#CC(=O)N1CCC[C@@H]1c1nc(c2n1ccnc2N)c1ccc(cc1)C(=O)Nc1ccccn1
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is R-Acalabrutinib (CAS: 1952316-43-6) typically synthesized?

R-Acalabrutinib is synthesized via a multi-step process involving the protection of a key functional...

Compound Q&A

What industries use R-Acalabrutinib (CAS: 1952316-43-6)?

R-Acalabrutinib is primarily used in the pharmaceutical industry for the treatment of hematologic ma...

Compound Q&A

What precautions should be taken when handling R-Acalabrutinib (CAS: 1952316-43-6)?

When handling R-Acalabrutinib, appropriate personal protective equipment (PPE) should be worn, inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...