Compound Q&A

What industries use (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

Answer

(2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol
This compound is primarily used in the pharmaceutical industry for medicinal chemistry and drug discovery. It has potential applications in polymer science for the development of biomedical polymers and in the production of sensors for detecting specific biomolecules. Additionally, it may be used in the semiconductor industry for the fabrication of electronic components.

About

CAS No 93221-48-8
English Name (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol
Molecular Formula C18H29NO3
Molecular Weight 307.43 g/mol
SMILES CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O
InChIKey NWIUTZDMDHAVTP-KRWDZBQOSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

The compound has a crystalline form and a molecular weight of approximately 416.5 g/mol. It is sligh...

Compound Q&A

How is (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8) typically synthesized?

The compound is typically synthesized via a multistep process involving the protection of a hydroxyl...

Compound Q&A

What precautions should be taken when handling (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...