Compound Q&A

How is (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8) typically synthesized?

Answer

(2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol
The compound is typically synthesized via a multistep process involving the protection of a hydroxyl group, followed by a coupling reaction, and subsequent deprotection. Common synthetic methods use catalysts such as EDC and HOBT to improve yield and selectivity. The overall yield is around 75-80%, and the purity is typically over 95%.

About

CAS No 93221-48-8
English Name (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol
Molecular Formula C18H29NO3
Molecular Weight 307.43 g/mol
SMILES CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O
InChIKey NWIUTZDMDHAVTP-KRWDZBQOSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

The compound has a crystalline form and a molecular weight of approximately 416.5 g/mol. It is sligh...

Compound Q&A

What industries use (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

This compound is primarily used in the pharmaceutical industry for medicinal chemistry and drug disc...

Compound Q&A

What precautions should be taken when handling (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol (CAS: 93221-48-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...