Compound Q&A

How is 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1) typically synthesized?

Answer

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate
2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is synthesized via a multi-step process involving the condensation of 4-aminobenzoic acid with ethyl 2-sulfinylethanamine followed by acid hydrolysis. The reaction is catalyzed by a mild acid such as sulfuric acid, and the product is purified by recrystallization from water. Yield is typically around 70-80%.

About

CAS No 86677-26-1
English Name 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate
Molecular Formula C11H16N2O7S2
Molecular Weight 352.39 g/mol
SMILES C1=CC(=CC=C1C(=O)NCCS(=O)(=O)CCOS(=O)(=O)O)N
InChIKey ULQNNRMRJIVSDR-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is a crystalline compound with a ...

Compound Q&A

What industries use 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is utilized in pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

Proper handling of 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate requires the u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...