Compound Q&A

What are the physical and chemical properties of 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

Answer

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate
2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is a crystalline compound with a molecular weight of approximately 322.29 g/mol. It has a high solubility in water and organic solvents. Chemically, it is reactive towards bases and can undergo hydrolysis under basic conditions. It is also susceptible to oxidation and requires storage in airtight containers to prevent degradation.

About

CAS No 86677-26-1
English Name 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate
Molecular Formula C11H16N2O7S2
Molecular Weight 352.39 g/mol
SMILES C1=CC(=CC=C1C(=O)NCCS(=O)(=O)CCOS(=O)(=O)O)N
InChIKey ULQNNRMRJIVSDR-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1) typically synthesized?

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is synthesized via a multi-step p...

Compound Q&A

What industries use 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate is utilized in pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate (CAS: 86677-26-1)?

Proper handling of 2-({2-[(4-Aminobenzoyl)amino]ethyl}sulfonyl)ethyl hydrogen sulfate requires the u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...