Compound Q&A

What industries use 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

Answer

2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol
This compound is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of certain drugs and is also utilized as a stabilizer or additive in polymer formulations due to its unique chemical structure.

About

English Name 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol
Molecular Formula C36H45N3O4
Molecular Weight 583.77 g/mol
SMILES CCC(CCCC)COCC(O)COc1cc(O)c(cc1)c2nc(nc(n2)c3ccc(C)cc3C)c4ccc(C)cc4C
InChIKey WYLMGXULBMHUDT-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

This compound is a crystalline solid with a molecular weight of approximately 626.5 g/mol. It has li...

Compound Q&A

How is 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8) typically synthesized?

This compound is synthesized through a multistep process involving the reaction of a triazine deriva...

Compound Q&A

What precautions should be taken when handling 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and lab coat, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...