Compound Q&A

What are the physical and chemical properties of 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

Answer

2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol
This compound is a crystalline solid with a molecular weight of approximately 626.5 g/mol. It has limited water solubility and is moderately soluble in common organic solvents like ethanol and acetone. Chemically, it shows good stability under normal conditions but may react with strong acids or bases. It is typically used in specialized applications requiring its unique structure.

About

English Name 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol
Molecular Formula C36H45N3O4
Molecular Weight 583.77 g/mol
SMILES CCC(CCCC)COCC(O)COc1cc(O)c(cc1)c2nc(nc(n2)c3ccc(C)cc3C)c4ccc(C)cc4C
InChIKey WYLMGXULBMHUDT-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8) typically synthesized?

This compound is synthesized through a multistep process involving the reaction of a triazine deriva...

Compound Q&A

What industries use 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

This compound is primarily used in the pharmaceutical and polymer industries. It serves as a key int...

Compound Q&A

What precautions should be taken when handling 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-{3-[(2-ethylhexyl)oxy]-2-hydroxypropoxy}phenol (CAS: 137658-79-8)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and lab coat, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...