Compound Q&A

What industries use 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

Answer

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate
2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is used in the pharmaceutical industry for its properties as a monomer and crosslinker, and in the polymer industry for the synthesis of functional polymers. It also finds applications in the production of sensors and semiconductors due to its reactivity and ability to form stable complexes.

About

English Name 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate
Molecular Formula C25H29NO3
Molecular Weight 380.53 g/mol
SMILES CCCCC(CC)COC(=O)C(=C(c1ccccc1)c2ccc(OC)cc2)C#N
InChIKey WAJCJDLRJVDSSD-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is a colorless to light yellow liquid with...

Compound Q&A

How is 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4) typically synthesized?

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is synthesized via a condensation reaction...

Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

When handling 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate, use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...