Compound Q&A

How is 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4) typically synthesized?

Answer

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate
2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is synthesized via a condensation reaction between 2-cyanoacryloyl chloride and 2-ethylhexyl methacrylate. The reaction is typically catalyzed by a tertiary amine and proceeds with good yield under anhydrous conditions. The product is isolated by distillation and recrystallization.

About

English Name 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate
Molecular Formula C25H29NO3
Molecular Weight 380.53 g/mol
SMILES CCCCC(CC)COC(=O)C(=C(c1ccccc1)c2ccc(OC)cc2)C#N
InChIKey WAJCJDLRJVDSSD-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is a colorless to light yellow liquid with...

Compound Q&A

What industries use 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate (CAS: 947753-66-4)?

When handling 2-Ethylhexyl 2-cyano-3-(4-methoxyphenyl)-3-phenylacrylate, use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...