Compound Q&A

What are the physical and chemical properties of Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4)?

Answer

Methyl 3-benzamidothiophene-2-carboxylate
Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4) is a crystalline solid with a molecular weight of approximately 269.3 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and ethanol. The compound exhibits good reactivity towards nucleophiles and can undergo condensation reactions. It has a melting point around 115-118°C and is stable under normal laboratory conditions.

About

CAS No 79128-70-4
English Name Methyl 3-benzamidothiophene-2-carboxylate
Molecular Formula C13H11NO3S
Molecular Weight 261.302 g/mol
SMILES COC(=O)C1=C(C=CS1)NC(=O)C2=CC=CC=C2
InChIKey ILRZDTPFHHAMMM-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4) typically synthesized?

Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4) is typically synthesized via a condensat...

Compound Q&A

What industries use Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4)?

Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4)?

When handling Methyl 3-benzamidothiophene-2-carboxylate (CAS: 79128-70-4), ensure the use of appropr...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...