Compound Q&A

How is Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6) typically synthesized?

Answer

Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes
The compound is synthesized by condensation of 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione with aluminum salts in the presence of a suitable catalyst under anhydrous conditions. The reaction yields a complex with high selectivity and good yield.

About

English Name Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes
Molecular Formula C18H11NO2
Molecular Weight 273.29 g/mol
EINECS 309-264-4
SMILES C1C=CC2C(=NC(C3C(=O)C4=CC=CC=C4C3=O)=CC=2)C=1
InChIKey IZMJMCDDWKSTTK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

The compound has a crystalline form with a molecular weight of approximately 450 g/mol. Solubility i...

Compound Q&A

What industries use Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

This compound is primarily used in the pharmaceutical industry for its metal-ligand complexation pro...

Compound Q&A

What precautions should be taken when handling Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...