Compound Q&A

What are the physical and chemical properties of Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

Answer

Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes
The compound has a crystalline form with a molecular weight of approximately 450 g/mol. Solubility in water is low. It is moderately reactive and can undergo complexation reactions with various metal ions. The compound is stable under normal storage conditions but may react with strong acids.

About

English Name Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes
Molecular Formula C18H11NO2
Molecular Weight 273.29 g/mol
EINECS 309-264-4
SMILES C1C=CC2C(=NC(C3C(=O)C4=CC=CC=C4C3=O)=CC=2)C=1
InChIKey IZMJMCDDWKSTTK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6) typically synthesized?

The compound is synthesized by condensation of 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione with aluminu...

Compound Q&A

What industries use Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

This compound is primarily used in the pharmaceutical industry for its metal-ligand complexation pro...

Compound Q&A

What precautions should be taken when handling Aluminum, 2-(2-quinolinyl)-1H-indene-1,3(2H)-dione sulfo derivs. complexes (CAS: 100208-62-6)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...