Compound Q&A

What are the physical and chemical properties of N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8)?

Answer

N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide
N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8) is a white crystalline solid with a molecular weight of approximately 349.06 g/mol. It has a melting point of 240-242°C and is poorly soluble in water but soluble in organic solvents such as ethanol and methanol. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions.

About

CAS No 55411-56-8
English Name N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide
Molecular Formula C13H9Cl2NO3
Molecular Weight 298.12 g/mol
SMILES C1=CC(=CC(=C1)O)C(=O)NC2=CC(=C(C(=C2)Cl)O)Cl
InChIKey ZYIZNUYMGIICGZ-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

How is N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8) typically synthesized?

N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8) is typically synthesized via t...

Compound Q&A

What industries use N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8)?

N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8) finds applications in the phar...

Compound Q&A

What precautions should be taken when handling N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8)?

When handling N-(3,5-Dichloro-4-hydroxyphenyl)-2-hydroxybenzamide (CAS: 55411-56-8), appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...