Compound Q&A

What industries use (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine (CAS: 869318-89-8)?

Answer

(1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine
(1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the semiconductor industry due to its electronic properties and in the development of new materials for sensors and polymers. Its unique chemical structure makes it a valuable intermediate in organic synthesis.

About

English Name (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine
Molecular Formula C13H18F3N
Molecular Weight 245.29 g/mol
SMILES CC(C)CC[C@@H](c1ccc(cc1)C(F)(F)F)N
InChIKey UYCLWAPCXBUSGP-LBPRGKRZSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine (CAS: 869318-89-8)?

(1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine is a white crystalline solid with a molecu...

Compound Q&A

How is (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine (CAS: 869318-89-8) typically synthesized?

(1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine is typically synthesized via a multistep p...

Compound Q&A

What precautions should be taken when handling (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine (CAS: 869318-89-8)?

When handling (1S)-4-Methyl-1-[4-(trifluoromethyl)phenyl]-1-pentanamine, it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...