Compound Q&A

What industries use (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

Answer

(2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one
This compound is primarily used in the pharmaceutical industry for the development of new drug candidates. It is also utilized in the polymer industry as a precursor for the synthesis of functional polymers with specific properties. Additionally, it has potential applications in the production of sensors and semiconductors due to its optical and electronic properties.

About

CAS No 74628-43-6
English Name (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one
Molecular Formula C19H20O6
Molecular Weight 344.36 g/mol
SMILES COC1=CC=C(C=C1OC)[C@@H]1CC(=O)C2C(=CC(=CC=2OC)OC)O1
InChIKey FPXNMRFTZWGJIT-HNNXBMFYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

The compound (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one is a crystallin...

Compound Q&A

How is (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6) typically synthesized?

This compound can be synthesized via a multistep reaction involving the protection of a phenolic hyd...

Compound Q&A

What precautions should be taken when handling (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

When handling (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one, it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...