Compound Q&A

How is (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6) typically synthesized?

Answer

(2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one
This compound can be synthesized via a multistep reaction involving the protection of a phenolic hydroxyl group, followed by a condensation reaction to form the chromone skeleton. Common methods include the use of acetic anhydride for protection and the Birch reduction for the formation of the chromone. The reaction is typically conducted under anhydrous conditions with a yield of around 70-80%, and high selectivity towards the desired diastereoisomer.

About

CAS No 74628-43-6
English Name (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one
Molecular Formula C19H20O6
Molecular Weight 344.36 g/mol
SMILES COC1=CC=C(C=C1OC)[C@@H]1CC(=O)C2C(=CC(=CC=2OC)OC)O1
InChIKey FPXNMRFTZWGJIT-HNNXBMFYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

The compound (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one is a crystallin...

Compound Q&A

What industries use (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

This compound is primarily used in the pharmaceutical industry for the development of new drug candi...

Compound Q&A

What precautions should be taken when handling (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one (CAS: 74628-43-6)?

When handling (2S)-2-(3,4-Dimethoxyphenyl)-5,7-dimethoxy-2,3-dihydro-4H-chromen-4-one, it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...