Compound Q&A

What industries use Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

Answer

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate
Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) shows potential applications in pharmaceuticals, particularly in the development of iodine-containing compounds for antiseptic and antibiotic purposes. It may also be used in the synthesis of other organic compounds and in research for its unique spectral and reactivity properties.

About

CAS No 83249-56-3
English Name Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate
Molecular Formula C20H21I2NO5
Molecular Weight 609.2 g/mol
SMILES CCOC(=O)C(CC1=CC(=C(C(=C1)I)OC2=CC=C(C=C2)OC)I)NC(=O)C
InChIKey LCJKMEUFNHSFPB-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) is a crystalline solid wit...

Compound Q&A

How is Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) typically synthesized?

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate is synthesized through a multi-step process ...

Compound Q&A

What precautions should be taken when handling Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

When handling Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...