Compound Q&A

How is Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) typically synthesized?

Answer

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate
Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate is synthesized through a multi-step process involving the protection of tyrosine, acetylation, and iodination. Commonly, an iodine source and a Lewis acid catalyst are used to introduce the iodine atoms. The exact yield and selectivity depend on reaction conditions and the choice of reagents.

About

CAS No 83249-56-3
English Name Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate
Molecular Formula C20H21I2NO5
Molecular Weight 609.2 g/mol
SMILES CCOC(=O)C(CC1=CC(=C(C(=C1)I)OC2=CC=C(C=C2)OC)I)NC(=O)C
InChIKey LCJKMEUFNHSFPB-UHFFFAOYSA-N
Last Updated: 2026-03-28 13:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) is a crystalline solid wit...

Compound Q&A

What industries use Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3) shows potential applicatio...

Compound Q&A

What precautions should be taken when handling Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3)?

When handling Ethyl N-acetyl-3,5-diiodo-O-(4-methoxyphenyl)tyrosinate (CAS: 83249-56-3), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...