Compound Q&A

How is Cyclosporin (CAS: 108027-39-0) typically synthesized?

Answer

Cyclosporin; Cyclosporin L
Cyclosporin (CAS: 108027-39-0) is typically synthesized through a semi-synthetic route starting from cycloartenol. The synthesis involves multiple steps, including enzymatic reactions, acetylation, and ring closure. Common catalysts include enzymes and chemical reagents, with high yield and selectivity achieved through careful control of reaction conditions.

About

English Name Cyclosporin; Cyclosporin L
Molecular Formula C61H109N11O12
Molecular Weight 1188.59 g/mol
SMILES CCC1NC(=O)C(NC(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C)C(O)C(C)C\C=C\C
InChIKey ZSNYYEIGOZADKA-SHHOIMCASA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclosporin (CAS: 108027-39-0)?

Cyclosporin (CAS: 108027-39-0) is a cyclic oligopeptide. It has a molecular weight of approximately ...

Compound Q&A

What industries use Cyclosporin (CAS: 108027-39-0)?

Cyclosporin (CAS: 108027-39-0) is primarily used in the pharmaceutical industry, particularly in the...

Compound Q&A

What precautions should be taken when handling Cyclosporin (CAS: 108027-39-0)?

When handling Cyclosporin (CAS: 108027-39-0), it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...