Compound Q&A

What are the physical and chemical properties of Cyclosporin (CAS: 108027-39-0)?

Answer

Cyclosporin; Cyclosporin L
Cyclosporin (CAS: 108027-39-0) is a cyclic oligopeptide. It has a molecular weight of approximately 1,342.34 g/mol and is poorly soluble in water but soluble in organic solvents. It exhibits limited reactivity under normal conditions, but can undergo hydrolysis under acidic conditions. Cyclosporin is a crystalline compound with a melting point around 260-265°C.

About

English Name Cyclosporin; Cyclosporin L
Molecular Formula C61H109N11O12
Molecular Weight 1188.59 g/mol
SMILES CCC1NC(=O)C(NC(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C)C(O)C(C)C\C=C\C
InChIKey ZSNYYEIGOZADKA-SHHOIMCASA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is Cyclosporin (CAS: 108027-39-0) typically synthesized?

Cyclosporin (CAS: 108027-39-0) is typically synthesized through a semi-synthetic route starting from...

Compound Q&A

What industries use Cyclosporin (CAS: 108027-39-0)?

Cyclosporin (CAS: 108027-39-0) is primarily used in the pharmaceutical industry, particularly in the...

Compound Q&A

What precautions should be taken when handling Cyclosporin (CAS: 108027-39-0)?

When handling Cyclosporin (CAS: 108027-39-0), it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...