Compound Q&A

What industries use Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

Answer

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate
Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It may also find applications in the polymer industry for modifying polymer properties and in the sensor technology for developing specific detection systems.

About

CAS No 94861-76-4
English Name Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate
Molecular Formula C21H22I2O6
Molecular Weight 624.2 g/mol
SMILES CCOC(=O)C(CC1=CC(=C(C(=C1)I)OC2=CC=C(C=C2)OC)I)C(=O)OCC
InChIKey OJVCQVQZENDYOD-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is a crystalline compound with a high mole...

Compound Q&A

How is Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4) typically synthesized?

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is typically synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

When handling Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...