Compound Q&A

What are the physical and chemical properties of Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

Answer

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate
Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is a crystalline compound with a high molecular weight. It has low solubility in water but is soluble in organic solvents. The compound is highly reactive due to the presence of iodine and phenolic groups. It exhibits poor reactivity with common organic reagents but can undergo specific transformations under controlled conditions.

About

CAS No 94861-76-4
English Name Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate
Molecular Formula C21H22I2O6
Molecular Weight 624.2 g/mol
SMILES CCOC(=O)C(CC1=CC(=C(C(=C1)I)OC2=CC=C(C=C2)OC)I)C(=O)OCC
InChIKey OJVCQVQZENDYOD-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4) typically synthesized?

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is typically synthesized through a multi-s...

Compound Q&A

What industries use Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate (CAS: 94861-76-4)?

When handling Diethyl 2-(3,5-diiodo-4-(4-methoxyphenoxy)benzyl)malonate, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...