Compound Q&A

How is (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7) typically synthesized?

Answer

(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (1:1)
This compound can be synthesized via a multistep process involving nucleophilic substitution and alkylation reactions. Commonly, dimethylamine is reacted with 3-methoxyphenylmethyl chloride to form the alcohol, which is then reacted with 2-methylpentanal to form the final compound. The reaction typically involves use of a catalyst and proceeds with good selectivity and yield.

About

English Name (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (1:1)
Molecular Formula C15H26ClNO2
Molecular Weight 287.83 g/mol
SMILES CC[C@](c1cccc(c1)OC)([C@H](C)CN(C)C)O.Cl
InChIKey JWPQTVRDQHIIHD-XRZFDKQNSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

This compound is a white to off-white crystalline solid with a molecular weight of approximately 324...

Compound Q&A

What industries use (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drug mol...

Compound Q&A

What precautions should be taken when handling (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

Proper personal protective equipment (PPE) such as gloves, laboratory coat, and safety goggles shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...