Compound Q&A

What are the physical and chemical properties of (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

Answer

(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (1:1)
This compound is a white to off-white crystalline solid with a molecular weight of approximately 324.38 g/mol. It is slightly soluble in water and slightly soluble in ethanol. The compound is moderately reactive, particularly towards bases and reducing agents. It can be affected by heat and light, leading to degradation over time.

About

English Name (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (1:1)
Molecular Formula C15H26ClNO2
Molecular Weight 287.83 g/mol
SMILES CC[C@](c1cccc(c1)OC)([C@H](C)CN(C)C)O.Cl
InChIKey JWPQTVRDQHIIHD-XRZFDKQNSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7) typically synthesized?

This compound can be synthesized via a multistep process involving nucleophilic substitution and alk...

Compound Q&A

What industries use (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drug mol...

Compound Q&A

What precautions should be taken when handling (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride (CAS: 175590-75-7)?

Proper personal protective equipment (PPE) such as gloves, laboratory coat, and safety goggles shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...