Compound Q&A

How is Lithium dicyclohexylazanide (CAS: 4111-55-1) typically synthesized?

Answer

Lithium dicyclohexylazanide
Lithium dicyclohexylazanide (CAS: 4111-55-1) can be synthesized by the reaction of lithium salt with dicyclohexylamine. Common methods involve using lithium chloride or lithium bromide with dicyclohexylamine in an inert solvent like toluene. The process yields a high purity product with good selectivity.

About

CAS No 4111-55-1
English Name Lithium dicyclohexylazanide
Molecular Formula C12H22LiN
Molecular Weight 187.3 g/mol
SMILES [Li+].C1CCC(CC1)[N-]C2CCCCC2
InChIKey HTZGVHYSMVGNOV-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lithium dicyclohexylazanide (CAS: 4111-55-1)?

Lithium dicyclohexylazanide (CAS: 4111-55-1) is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use Lithium dicyclohexylazanide (CAS: 4111-55-1)?

Lithium dicyclohexylazanide (CAS: 4111-55-1) is primarily used in the pharmaceutical and fine chemic...

Compound Q&A

What precautions should be taken when handling Lithium dicyclohexylazanide (CAS: 4111-55-1)?

When handling Lithium dicyclohexylazanide (CAS: 4111-55-1), it is essential to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...