Compound Q&A

What are the physical and chemical properties of Lithium dicyclohexylazanide (CAS: 4111-55-1)?

Answer

Lithium dicyclohexylazanide
Lithium dicyclohexylazanide (CAS: 4111-55-1) is a white crystalline solid with a molecular weight of approximately 228.3 g/mol. It has a melting point of around 60°C and is slightly soluble in water. It is a highly reactive compound, prone to hydrolysis and can react with amines. It is used in organic synthesis as a strong base and nucleophile.

About

CAS No 4111-55-1
English Name Lithium dicyclohexylazanide
Molecular Formula C12H22LiN
Molecular Weight 187.3 g/mol
SMILES [Li+].C1CCC(CC1)[N-]C2CCCCC2
InChIKey HTZGVHYSMVGNOV-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is Lithium dicyclohexylazanide (CAS: 4111-55-1) typically synthesized?

Lithium dicyclohexylazanide (CAS: 4111-55-1) can be synthesized by the reaction of lithium salt with...

Compound Q&A

What industries use Lithium dicyclohexylazanide (CAS: 4111-55-1)?

Lithium dicyclohexylazanide (CAS: 4111-55-1) is primarily used in the pharmaceutical and fine chemic...

Compound Q&A

What precautions should be taken when handling Lithium dicyclohexylazanide (CAS: 4111-55-1)?

When handling Lithium dicyclohexylazanide (CAS: 4111-55-1), it is essential to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...