Compound Q&A

How is (Z)-Roxithromycin (CAS: 134931-00-3) typically synthesized?

Answer

(Z)-Roxithromycin
(Z)-Roxithromycin is synthesized via a semi-synthetic route from erythromycin, with key steps involving azalide formation and modification of the macrolide ring. The synthesis typically requires catalysts such as platinum(II) tetraacetate, and yields around 70-80%. The reaction is selective and environmentally friendly.

About

English Name (Z)-Roxithromycin
Molecular Formula C41H76N2O15
Molecular Weight 837.06 g/mol
SMILES CC[C@@H]1[C@@]([C@@H]([C@H](/C(=N\OCOCCOC)/[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O
InChIKey RXZBMPWDPOLZGW-HEWSMUCTSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Z)-Roxithromycin (CAS: 134931-00-3)?

(Z)-Roxithromycin is a semi-synthetic macrolide antibiotic with a molecular weight of approximately ...

Compound Q&A

What industries use (Z)-Roxithromycin (CAS: 134931-00-3)?

(Z)-Roxithromycin is primarily used in the pharmaceutical industry for treating bacterial infections...

Compound Q&A

What precautions should be taken when handling (Z)-Roxithromycin (CAS: 134931-00-3)?

When handling (Z)-Roxithromycin, use appropriate personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...