Compound Q&A

What are the physical and chemical properties of (Z)-Roxithromycin (CAS: 134931-00-3)?

Answer

(Z)-Roxithromycin
(Z)-Roxithromycin is a semi-synthetic macrolide antibiotic with a molecular weight of approximately 869.9 g/mol. It is a white to off-white crystalline powder. Soluble in methanol, ethanol, and acetone but virtually insoluble in water. It shows moderate reactivity towards basic conditions and is stable under acidic conditions.

About

English Name (Z)-Roxithromycin
Molecular Formula C41H76N2O15
Molecular Weight 837.06 g/mol
SMILES CC[C@@H]1[C@@]([C@@H]([C@H](/C(=N\OCOCCOC)/[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O
InChIKey RXZBMPWDPOLZGW-HEWSMUCTSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is (Z)-Roxithromycin (CAS: 134931-00-3) typically synthesized?

(Z)-Roxithromycin is synthesized via a semi-synthetic route from erythromycin, with key steps involv...

Compound Q&A

What industries use (Z)-Roxithromycin (CAS: 134931-00-3)?

(Z)-Roxithromycin is primarily used in the pharmaceutical industry for treating bacterial infections...

Compound Q&A

What precautions should be taken when handling (Z)-Roxithromycin (CAS: 134931-00-3)?

When handling (Z)-Roxithromycin, use appropriate personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...