Compound Q&A

How is 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4) typically synthesized?

Answer

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane
2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is typically synthesized through the condensation of 1,3,5,7-tetramethylcyclotetrasiloxane with divinyltetramethysiloxane. The reaction proceeds with the aid of a basic catalyst, such as potassium tert-butoxide, and yields a product with high purity and selectivity.

About

CAS No 27342-69-4
English Name 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane
Molecular Formula C12H24O4Si4
Molecular Weight 344.66 g/mol
SMILES C[Si]1(O[Si](O[Si](O[Si](O1)(C)C=C)(C)C=C)(C)C=C)C=C
InChIKey VMAWODUEPLAHOE-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is a colorless, viscous liquid with a molec...

Compound Q&A

What industries use 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is widely used in the semiconductor industr...

Compound Q&A

What precautions should be taken when handling 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

When handling 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane, wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...