Compound Q&A

What are the physical and chemical properties of 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

Answer

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane
2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is a colorless, viscous liquid with a molecular weight of approximately 296.3 g/mol. It has a high boiling point and is poorly soluble in water but soluble in organic solvents. This compound is highly reactive due to the presence of vinyl groups, making it suitable for polymerization reactions.

About

CAS No 27342-69-4
English Name 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane
Molecular Formula C12H24O4Si4
Molecular Weight 344.66 g/mol
SMILES C[Si]1(O[Si](O[Si](O[Si](O1)(C)C=C)(C)C=C)(C)C=C)C=C
InChIKey VMAWODUEPLAHOE-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4) typically synthesized?

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is typically synthesized through the conden...

Compound Q&A

What industries use 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane is widely used in the semiconductor industr...

Compound Q&A

What precautions should be taken when handling 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane (CAS: 27342-69-4)?

When handling 2,4,6,8-Tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane, wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...