Compound Q&A

What precautions should be taken when handling N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

Answer

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide
When handling N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. It should be stored in a cool, dry place away from direct sunlight and flammable materials. In case of a spill, it is recommended to use appropriate absorbent materials and consult the safety data sheet (SDS) for further guidance.

About

English Name N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide
Molecular Formula C15H15N3OS
Molecular Weight 285.37 g/mol
SMILES c1ccc2c(c1)c(ccc2NC(=S)NNC=O)C3CC3
InChIKey HGCUOCICQCDBJN-UHFFFAOYSA-N
Last Updated: 2026-03-26 04:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide is a crystalline compound with a molecu...

Compound Q&A

How is N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6) typically synthesized?

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide can be synthesized through a multi-step...

Compound Q&A

What industries use N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide is primarily used in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...