Compound Q&A

What are the physical and chemical properties of N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

Answer

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide
N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide is a crystalline compound with a molecular weight of approximately 347.34 g/mol. It has low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound exhibits moderate reactivity, particularly towards nucleophiles and reducing agents. It can be stored at room temperature away from moisture and direct sunlight.

About

English Name N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide
Molecular Formula C15H15N3OS
Molecular Weight 285.37 g/mol
SMILES c1ccc2c(c1)c(ccc2NC(=S)NNC=O)C3CC3
InChIKey HGCUOCICQCDBJN-UHFFFAOYSA-N
Last Updated: 2026-03-26 04:30

Related Q&A

Compound Q&A

How is N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6) typically synthesized?

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide can be synthesized through a multi-step...

Compound Q&A

What industries use N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide (CAS: 1533519-86-6)?

When handling N-(4-Cyclopropyl-1-naphthyl)-2-formylhydrazinecarbothioamide, appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...