Compound Q&A

What is 3-Nitro-2-phenylthiophene (CAS: 18150-94-2)?

Answer

3-Nitro-2-phenylthiophene
3-Nitro-2-phenylthiophene is an organic compound with the CAS number 18150-94-2. It is a thiophene derivative with a nitro group attached to the second position and a phenyl group attached to the second position as well. This compound is characterized by its aromatic nature and specific functional groups which influence its chemical reactivity and physical properties.

About

CAS No 18150-94-2
English Name 3-Nitro-2-phenylthiophene
Molecular Formula C10H7NO2S
Molecular Weight 205.2331 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=CS2)[N+](=O)[O-]
InChIKey MOMYURHNCLKYIA-UHFFFAOYSA-N
Last Updated: 2026-03-25 19:00

Related Q&A

Compound Q&A

What are the main uses of 3-Nitro-2-phenylthiophene (CAS: 18150-94-2)?

3-Nitro-2-phenylthiophene is primarily used in the synthesis of other organic compounds, particularl...

Compound Q&A

Is 3-Nitro-2-phenylthiophene (CAS: 18150-94-2) safe?

3-Nitro-2-phenylthiophene, like many organic compounds, requires proper handling and safety precauti...

Compound Q&A

How should 3-Nitro-2-phenylthiophene (CAS: 18150-94-2) be stored?

3-Nitro-2-phenylthiophene should be stored in a cool, dry place, protected from direct sunlight and ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...