Compound Q&A

What industries use 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

Answer

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid
2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) is primarily used in the pharmaceutical industry for its role in drug synthesis and analysis, as well as in the polymer industry for its applications in functional polymers. It also finds use in the development of sensors and semiconductors due to its unique chemical properties and reactivity.

About

CAS No 81417-89-2
English Name 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid
Molecular Formula C12H13NO9S3
Molecular Weight 411.44 g/mol
SMILES C1=CC2=C(C=CC(=C2S(=O)(=O)O)N)C=C1S(=O)(=O)CCOS(=O)(=O)O
InChIKey FSRFGSIFTOWRLP-UHFFFAOYSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) is a crystallin...

Compound Q&A

How is 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) typically synthesized?

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) can be synthesi...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

When handling 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...