Compound Q&A

What are the physical and chemical properties of 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

Answer

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid
2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) is a crystalline compound with a molecular weight of approximately 503.5 g/mol. It has a low solubility in water at room temperature. The compound is known for its high reactivity towards nucleophiles and its ability to form complexes with various metal ions. It is typically used in analytical chemistry for its spectroscopic and chromatographic properties.

About

CAS No 81417-89-2
English Name 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid
Molecular Formula C12H13NO9S3
Molecular Weight 411.44 g/mol
SMILES C1=CC2=C(C=CC(=C2S(=O)(=O)O)N)C=C1S(=O)(=O)CCOS(=O)(=O)O
InChIKey FSRFGSIFTOWRLP-UHFFFAOYSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

How is 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) typically synthesized?

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) can be synthesi...

Compound Q&A

What industries use 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2) is primarily us...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2)?

When handling 2-Amino-6-{[2-(sulfooxy)ethyl]sulfonyl}-1-naphthalenesulfonic acid (CAS: 81417-89-2), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...