Compound Q&A

How is N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) typically synthesized?

Answer

N-(3-Nitrophenyl)-3-oxobutanamide
N-(3-Nitrophenyl)-3-oxobutanamide is typically synthesized via the condensation of 3-oxobutanoyl chloride with 3-nitrophenol in the presence of a base like pyridine. The reaction is carried out under anhydrous conditions, and the product is isolated by crystallization from an appropriate solvent. The yield is generally good, around 70-85%.

About

CAS No 25233-49-2
English Name N-(3-Nitrophenyl)-3-oxobutanamide
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES CC(=O)CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-]
InChIKey KQAQKCOLRNMYFK-UHFFFAOYSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) is a white crystalline solid with a molecular we...

Compound Q&A

What industries use N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

When handling N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...