Compound Q&A

What are the physical and chemical properties of N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

Answer

N-(3-Nitrophenyl)-3-oxobutanamide
N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) is a white crystalline solid with a molecular weight of approximately 226.09 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and acetonitrile. This compound is known for its reactivity, particularly towards nucleophiles, and can undergo reactions such as substitution and elimination.

About

CAS No 25233-49-2
English Name N-(3-Nitrophenyl)-3-oxobutanamide
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES CC(=O)CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-]
InChIKey KQAQKCOLRNMYFK-UHFFFAOYSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

How is N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) typically synthesized?

N-(3-Nitrophenyl)-3-oxobutanamide is typically synthesized via the condensation of 3-oxobutanoyl chl...

Compound Q&A

What industries use N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2)?

When handling N-(3-Nitrophenyl)-3-oxobutanamide (CAS: 25233-49-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...