Compound Q&A

How is Poly(nipam-maa) (CAS: 151954-97-1) typically synthesized?

Answer

Poly(nipam-maa)
Poly(nipam-maa) (CAS: 151954-97-1) is typically synthesized via free radical polymerization using initiators like azobisisobutyronitrile (AIBN) or thermal decomposition of peroxy compounds. The polymerization process is conducted in aqueous or organic media. Commonly, the monomer mixture is heated under nitrogen atmosphere, and the polymerization is monitored using techniques like gel permeation chromatography (GPC) to control molecular weight and copolymer composition.

About

English Name Poly(nipam-maa)
Molecular Formula C10H17NO3
Molecular Weight 199.25 g/mol
SMILES CC(C)NC(=O)C=C.CC(=C)C(=O)O
InChIKey BGJOTKHBFYMJST-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Poly(nipam-maa) (CAS: 151954-97-1)?

Poly(nipam-maa) is a copolymer with a CAS number of 151954-97-1. It typically has a glass transition...

Compound Q&A

What industries use Poly(nipam-maa) (CAS: 151954-97-1)?

Poly(nipam-maa) (CAS: 151954-97-1) finds applications in various industries. It is widely used in ph...

Compound Q&A

What precautions should be taken when handling Poly(nipam-maa) (CAS: 151954-97-1)?

When handling Poly(nipam-maa) (CAS: 151954-97-1), it is important to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...