Compound Q&A

What industries use 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

Answer

5-Nitroquinoline 1-oxide
5-Nitroquinoline 1-oxide (CAS: 7613-19-6) is used in the pharmaceutical industry for the synthesis of certain organic compounds. It is also applied in the semiconductor industry for doping materials. Additionally, it has applications in sensing technology due to its fluorescence properties, making it useful in sensors for detecting specific analytes.

About

CAS No 7613-19-6
English Name 5-Nitroquinoline 1-oxide
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC2=C(C=CC=[N+]2[O-])C(=C1)[N+](=O)[O-]
InChIKey CMZRGZILWKLDMH-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

5-Nitroquinoline 1-oxide (CAS: 7613-19-6) is a crystalline solid with a molecular weight of 209.07 g...

Compound Q&A

How is 5-Nitroquinoline 1-oxide (CAS: 7613-19-6) typically synthesized?

5-Nitroquinoline 1-oxide can be synthesized by nitration of quinoline-1-oxide. The reaction typicall...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

When handling 5-Nitroquinoline 1-oxide (CAS: 7613-19-6), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...