Compound Q&A

What are the physical and chemical properties of 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

Answer

5-Nitroquinoline 1-oxide
5-Nitroquinoline 1-oxide (CAS: 7613-19-6) is a crystalline solid with a molecular weight of 209.07 g/mol. It has a high solubility in organic solvents like methanol and ethanol but is slightly soluble in water. Chemically, it is highly reactive, particularly towards nucleophiles and reducing agents, making it useful in various synthetic reactions.

About

CAS No 7613-19-6
English Name 5-Nitroquinoline 1-oxide
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC2=C(C=CC=[N+]2[O-])C(=C1)[N+](=O)[O-]
InChIKey CMZRGZILWKLDMH-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is 5-Nitroquinoline 1-oxide (CAS: 7613-19-6) typically synthesized?

5-Nitroquinoline 1-oxide can be synthesized by nitration of quinoline-1-oxide. The reaction typicall...

Compound Q&A

What industries use 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

5-Nitroquinoline 1-oxide (CAS: 7613-19-6) is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinoline 1-oxide (CAS: 7613-19-6)?

When handling 5-Nitroquinoline 1-oxide (CAS: 7613-19-6), it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...