Compound Q&A

How is (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1) typically synthesized?

Answer

(4-Bromo-2-fluorophenoxy)acetic acid
(4-Bromo-2-fluorophenoxy)acetic acid is typically synthesized via a multi-step process involving bromination of 2-fluorophenol followed by esterification. Commonly, a Grignard reagent or a bromoalkane is used as the brominating agent, and acetic anhydride is employed for esterification. The yield is generally around 70-80%, and the reaction is monitored using chromatography.

About

CAS No 451-90-1
English Name (4-Bromo-2-fluorophenoxy)acetic acid
Molecular Formula C8H6BrFO3
Molecular Weight 249.03 g/mol
SMILES C1=CC(=C(C=C1Br)F)OCC(=O)O
InChIKey HPXDHKIIFGVHOU-UHFFFAOYSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

(4-Bromo-2-fluorophenoxy)acetic acid is a white or off-white crystalline solid with a molecular weig...

Compound Q&A

What industries use (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

(4-Bromo-2-fluorophenoxy)acetic acid is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

When handling (4-Bromo-2-fluorophenoxy)acetic acid, appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...