Compound Q&A

What are the physical and chemical properties of (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

Answer

(4-Bromo-2-fluorophenoxy)acetic acid
(4-Bromo-2-fluorophenoxy)acetic acid is a white or off-white crystalline solid with a molecular weight of approximately 281.04 g/mol. It has a low water solubility and is slightly soluble in organic solvents. The compound is known for its reactivity towards nucleophilic substitution reactions and can undergo esterification and acylation. It is stable under normal conditions but should be stored away from moisture and oxidizing agents.

About

CAS No 451-90-1
English Name (4-Bromo-2-fluorophenoxy)acetic acid
Molecular Formula C8H6BrFO3
Molecular Weight 249.03 g/mol
SMILES C1=CC(=C(C=C1Br)F)OCC(=O)O
InChIKey HPXDHKIIFGVHOU-UHFFFAOYSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

How is (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1) typically synthesized?

(4-Bromo-2-fluorophenoxy)acetic acid is typically synthesized via a multi-step process involving bro...

Compound Q&A

What industries use (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

(4-Bromo-2-fluorophenoxy)acetic acid is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling (4-Bromo-2-fluorophenoxy)acetic acid (CAS: 451-90-1)?

When handling (4-Bromo-2-fluorophenoxy)acetic acid, appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...