Compound Q&A

How is PV8 hydrochloride (CAS: 13415-55-9) typically synthesized?

Answer

PV8 (hydrochloride)
PV8 hydrochloride is synthesized through a multistep process involving the reaction of a specific precursor with hydrochloric acid. The reaction is typically conducted at room temperature under a nitrogen atmosphere. Common catalysts include various metal salts. The process yields high purity PV8 hydrochloride with good selectivity and a yield of about 85-90%.

About

CAS No 13415-55-9
English Name PV8 (hydrochloride)
Molecular Formula C17H26ClNO
Molecular Weight 295.85 g/mol
SMILES CCCCCC(C(=O)C1=CC=CC=C1)N2CCCC2.Cl
InChIKey WHQOZXALFDXFRH-UHFFFAOYSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of PV8 hydrochloride (CAS: 13415-55-9)?

PV8 hydrochloride is a white crystalline powder with a molecular weight of approximately 299.66 g/mo...

Compound Q&A

What industries use PV8 hydrochloride (CAS: 13415-55-9)?

PV8 hydrochloride finds applications in the pharmaceutical industry for its use as an intermediate i...

Compound Q&A

What precautions should be taken when handling PV8 hydrochloride (CAS: 13415-55-9)?

PV8 hydrochloride should be handled in a well-ventilated area or a fume hood to prevent inhalation o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...