Compound Q&A

What are the physical and chemical properties of PV8 hydrochloride (CAS: 13415-55-9)?

Answer

PV8 (hydrochloride)
PV8 hydrochloride is a white crystalline powder with a molecular weight of approximately 299.66 g/mol. It has poor solubility in water but is soluble in organic solvents. PV8 hydrochloride is moderately reactive and can undergo hydrolysis under basic conditions. Its stability depends on pH and temperature.

About

CAS No 13415-55-9
English Name PV8 (hydrochloride)
Molecular Formula C17H26ClNO
Molecular Weight 295.85 g/mol
SMILES CCCCCC(C(=O)C1=CC=CC=C1)N2CCCC2.Cl
InChIKey WHQOZXALFDXFRH-UHFFFAOYSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

How is PV8 hydrochloride (CAS: 13415-55-9) typically synthesized?

PV8 hydrochloride is synthesized through a multistep process involving the reaction of a specific pr...

Compound Q&A

What industries use PV8 hydrochloride (CAS: 13415-55-9)?

PV8 hydrochloride finds applications in the pharmaceutical industry for its use as an intermediate i...

Compound Q&A

What precautions should be taken when handling PV8 hydrochloride (CAS: 13415-55-9)?

PV8 hydrochloride should be handled in a well-ventilated area or a fume hood to prevent inhalation o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...