Compound Q&A

How is 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8) typically synthesized?

Answer

2,2',3,4',5,6-Hexachlorobiphenyl
2,2',3,4',5,6-Hexachlorobiphenyl is typically synthesized through a series of chlorination reactions of biphenyl using chlorine gas as the chlorinating agent. The process involves multiple steps and requires careful control of reaction conditions to achieve high selectivity and yield.

About

CAS No 68194-13-8
English Name 2,2',3,4',5,6-Hexachlorobiphenyl
Molecular Formula C12H4Cl6
Molecular Weight 360.88 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl
InChIKey AQONCPKMJSBHQT-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

2,2',3,4',5,6-Hexachlorobiphenyl is a crystalline solid with a high molecular weight and limited sol...

Compound Q&A

What industries use 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

2,2',3,4',5,6-Hexachlorobiphenyl was historically used in the production of flame retardants, but it...

Compound Q&A

What precautions should be taken when handling 2,2',3,4',5,6-Hexachlorobiphenyl (CAS: 68194-13-8)?

When handling 2,2',3,4',5,6-Hexachlorobiphenyl, it is essential to use personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...